Compound Q&A

What regulatory guidelines apply to 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8)?

Answer

3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate
3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) falls under various regulatory guidelines. It is subject to the Globally Harmonized System of Classification and Labelling of Chemicals (GHS), including classification for health and environmental hazards. In the EU, it is regulated under REACH, which requires suppliers to register substances above 1 tonne per year. It is also subject to FDA regulations in the US for any pharmaceutical or food-related applications, and EPA regulations for environmental protection and waste management.

About

English Name 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate
Molecular Formula C11H19NO5
Molecular Weight 245.27499999999998 g/mol
SMILES COC(=O)C1COCCN1C(=O)OC(C)(C)C
InChIKey KHKJMJAQUGFIHO-UHFFFAOYSA-N
Last Updated: 2025-11-03 09:36

Related Q&A

Compound Q&A

Are there alternatives to 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) in synthesis?

There are alternatives to 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-...

Compound Q&A

What is the market or research trend for 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8)?

The market for 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) is cu...

Compound Q&A

How should waste containing 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) be handled?

Waste containing 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) sho...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...