Compound Q&A

What precautions should be taken when handling 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

Answer

3,4-Di-O-acetyl-6-deoxy-L-glucal (Technical Grade)
When handling 3,4-Di-O-acetyl-6-deoxy-L-glucal, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be thoroughly decontaminated. Always refer to the safety data sheet (SDS) for detailed information on handling and storage.

About

CAS No 34819-86-8
English Name 3,4-Di-O-acetyl-6-deoxy-L-glucal (Technical Grade)
Molecular Formula C10H14O5
Molecular Weight 214.22 g/mol
SMILES CC1C(C(C=CO1)OC(=O)C)OC(=O)C
InChIKey NDEGMKQAZZBNBB-JUWDTYFHSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) is a white crystalline solid with a molecular wei...

Compound Q&A

How is 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) typically synthesized?

3,4-Di-O-acetyl-6-deoxy-L-glucal is typically synthesized through acetylation of 6-deoxy-L-glucal. T...

Compound Q&A

What industries use 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) is used in pharmaceuticals for the synthesis of b...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...