Compound Q&A

How is 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) typically synthesized?

Answer

3,4-Di-O-acetyl-6-deoxy-L-glucal (Technical Grade)
3,4-Di-O-acetyl-6-deoxy-L-glucal is typically synthesized through acetylation of 6-deoxy-L-glucal. This process involves the reaction of 6-deoxy-L-glucal with acetic anhydride in the presence of a catalyst such as pyridine under mild conditions. The yield is generally high, and the selectivity is excellent.

About

CAS No 34819-86-8
English Name 3,4-Di-O-acetyl-6-deoxy-L-glucal (Technical Grade)
Molecular Formula C10H14O5
Molecular Weight 214.22 g/mol
SMILES CC1C(C(C=CO1)OC(=O)C)OC(=O)C
InChIKey NDEGMKQAZZBNBB-JUWDTYFHSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) is a white crystalline solid with a molecular wei...

Compound Q&A

What industries use 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) is used in pharmaceuticals for the synthesis of b...

Compound Q&A

What precautions should be taken when handling 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

When handling 3,4-Di-O-acetyl-6-deoxy-L-glucal, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...