Compound Q&A

What industries use 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

Answer

3,4-Di-O-acetyl-6-deoxy-L-glucal (Technical Grade)
3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) is used in pharmaceuticals for the synthesis of bioactive compounds and in polymer industries for the development of novel materials. It also finds applications in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 34819-86-8
English Name 3,4-Di-O-acetyl-6-deoxy-L-glucal (Technical Grade)
Molecular Formula C10H14O5
Molecular Weight 214.22 g/mol
SMILES CC1C(C(C=CO1)OC(=O)C)OC(=O)C
InChIKey NDEGMKQAZZBNBB-JUWDTYFHSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) is a white crystalline solid with a molecular wei...

Compound Q&A

How is 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) typically synthesized?

3,4-Di-O-acetyl-6-deoxy-L-glucal is typically synthesized through acetylation of 6-deoxy-L-glucal. T...

Compound Q&A

What precautions should be taken when handling 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

When handling 3,4-Di-O-acetyl-6-deoxy-L-glucal, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...