Compound Q&A

What are the physical and chemical properties of 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

Answer

3,4-Di-O-acetyl-6-deoxy-L-glucal (Technical Grade)
3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) is a white crystalline solid with a molecular weight of approximately 326.34 g/mol. It is sparingly soluble in water but highly soluble in organic solvents such as methanol and ethanol. The compound is relatively stable but can react with reducing agents. Its melting point is around 145-147°C, and it decomposes above 200°C.

About

CAS No 34819-86-8
English Name 3,4-Di-O-acetyl-6-deoxy-L-glucal (Technical Grade)
Molecular Formula C10H14O5
Molecular Weight 214.22 g/mol
SMILES CC1C(C(C=CO1)OC(=O)C)OC(=O)C
InChIKey NDEGMKQAZZBNBB-JUWDTYFHSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) typically synthesized?

3,4-Di-O-acetyl-6-deoxy-L-glucal is typically synthesized through acetylation of 6-deoxy-L-glucal. T...

Compound Q&A

What industries use 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8) is used in pharmaceuticals for the synthesis of b...

Compound Q&A

What precautions should be taken when handling 3,4-Di-O-acetyl-6-deoxy-L-glucal (CAS: 34819-86-8)?

When handling 3,4-Di-O-acetyl-6-deoxy-L-glucal, it is crucial to wear appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...