Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8)?

Answer

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (1:1)
Proper handling of 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) requires the use of personal protective equipment (PPE) such as gloves, goggles, and a lab coat. It should be handled in a fume hood due to its potential for release of hydrogen chloride gas. Spills should be handled carefully, using suitable absorbents and following safety guidelines. Always refer to the Safety Data Sheet (SDS) for detailed information on handling and disposal.

About

English Name 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (1:1)
Molecular Formula C10H21ClN2O2
Molecular Weight 236.74 g/mol
SMILES CC(C)(C)OC(=O)NC1CCNCC1.Cl
InChIKey VVLJVJSHANVSGD-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8)?

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) is a crystalline solid w...

Compound Q&A

How is 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) typically synthesized?

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) is typically synthesized...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8)?

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) is primarily used in the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...