Compound Q&A

What industries use 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8)?

Answer

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (1:1)
2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It may also find applications in the polymer industry as a stabilizer or plasticizer. Additionally, it could be used in biosensors and as a chiral auxiliary in asymmetric synthesis.

About

English Name 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (1:1)
Molecular Formula C10H21ClN2O2
Molecular Weight 236.74 g/mol
SMILES CC(C)(C)OC(=O)NC1CCNCC1.Cl
InChIKey VVLJVJSHANVSGD-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8)?

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) is a crystalline solid w...

Compound Q&A

How is 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) typically synthesized?

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) is typically synthesized...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8)?

Proper handling of 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) requi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...