Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8)?

Answer

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (1:1)
2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) is a crystalline solid with a molecular weight of approximately 234.3 g/mol. It is slightly soluble in water and soluble in organic solvents such as ethanol and acetone. The compound exhibits moderate reactivity in acidic conditions and is stable in neutral to basic conditions. It has a pKa of about 3.5.

About

English Name 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (1:1)
Molecular Formula C10H21ClN2O2
Molecular Weight 236.74 g/mol
SMILES CC(C)(C)OC(=O)NC1CCNCC1.Cl
InChIKey VVLJVJSHANVSGD-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) typically synthesized?

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) is typically synthesized...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8)?

2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) is primarily used in the...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8)?

Proper handling of 2-Methyl-2-propanyl 4-piperidinylcarbamate hydrochloride (CAS: 179110-74-8) requi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...