Compound Q&A

What industries use Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6)?

Answer

Diethyl [(4-chlorobenzoyl)amino]malonate
Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6) is primarily used in the pharmaceutical industry for the synthesis of certain intermediates and in the polymer industry for the production of speciality polymers. It also finds applications in the sensor and semiconductor industries as a precursor for functional materials.

About

CAS No 81918-01-6
English Name Diethyl [(4-chlorobenzoyl)amino]malonate
Molecular Formula C14H16ClNO5
Molecular Weight 313.74 g/mol
SMILES CCOC(=O)C(C(=O)OCC)NC(=O)C1=CC=C(C=C1)Cl
InChIKey KTKBMOLVXVIHQA-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6)?

Diethyl [(4-chlorobenzoyl)amino]malonate is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6) typically synthesized?

Diethyl [(4-chlorobenzoyl)amino]malonate is typically synthesized by the reaction of ethyl malonate ...

Compound Q&A

What precautions should be taken when handling Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6)?

When handling Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...