Compound Q&A

What are the physical and chemical properties of Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6)?

Answer

Diethyl [(4-chlorobenzoyl)amino]malonate
Diethyl [(4-chlorobenzoyl)amino]malonate is a white crystalline solid with a molecular weight of approximately 322.18 g/mol. It has a low solubility in water but is soluble in organic solvents such as ethanol and acetone. Chemically, it is highly reactive, particularly towards nucleophiles, and it can undergo various reactions such as esterification and amidation.

About

CAS No 81918-01-6
English Name Diethyl [(4-chlorobenzoyl)amino]malonate
Molecular Formula C14H16ClNO5
Molecular Weight 313.74 g/mol
SMILES CCOC(=O)C(C(=O)OCC)NC(=O)C1=CC=C(C=C1)Cl
InChIKey KTKBMOLVXVIHQA-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6) typically synthesized?

Diethyl [(4-chlorobenzoyl)amino]malonate is typically synthesized by the reaction of ethyl malonate ...

Compound Q&A

What industries use Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6)?

Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6)?

When handling Diethyl [(4-chlorobenzoyl)amino]malonate (CAS: 81918-01-6), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...