Compound Q&A

What precautions should be taken when handling 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

Answer

1-(3-Nitrophenyl)ethanamine
When handling 1-(3-Nitrophenyl)ethanamine, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, safety goggles, and a lab coat. The compound should be handled in a well-ventilated area or a fume hood due to its volatility. Spills should be cleaned up using appropriate methods, and exposure to the compound should be minimized. Safety data sheets (SDS) should be referenced for detailed information on handling and storage.

About

CAS No 90271-37-7
English Name 1-(3-Nitrophenyl)ethanamine
Molecular Formula C8H10N2O2
Molecular Weight 166.18 g/mol
SMILES CC(C1=CC(=CC=C1)[N+](=O)[O-])N
InChIKey AVIBPONLEKDCPQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

1-(3-Nitrophenyl)ethanamine is a colorless to white crystalline solid with a molecular weight of app...

Compound Q&A

How is 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7) typically synthesized?

1-(3-Nitrophenyl)ethanamine is commonly synthesized through a condensation reaction between 3-nitrop...

Compound Q&A

What industries use 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

1-(3-Nitrophenyl)ethanamine finds applications in the pharmaceutical industry for the synthesis of v...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...