Compound Q&A

What are the physical and chemical properties of 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

Answer

1-(3-Nitrophenyl)ethanamine
1-(3-Nitrophenyl)ethanamine is a colorless to white crystalline solid with a molecular weight of approximately 177.13 g/mol. It has a pKa of about 9.2 and is slightly soluble in water. The compound is reactive towards nucleophiles and can undergo substitution reactions. It is highly sensitive to light and air oxidation.

About

CAS No 90271-37-7
English Name 1-(3-Nitrophenyl)ethanamine
Molecular Formula C8H10N2O2
Molecular Weight 166.18 g/mol
SMILES CC(C1=CC(=CC=C1)[N+](=O)[O-])N
InChIKey AVIBPONLEKDCPQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7) typically synthesized?

1-(3-Nitrophenyl)ethanamine is commonly synthesized through a condensation reaction between 3-nitrop...

Compound Q&A

What industries use 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

1-(3-Nitrophenyl)ethanamine finds applications in the pharmaceutical industry for the synthesis of v...

Compound Q&A

What precautions should be taken when handling 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

When handling 1-(3-Nitrophenyl)ethanamine, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...