Compound Q&A

What industries use 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

Answer

1-(3-Nitrophenyl)ethanamine
1-(3-Nitrophenyl)ethanamine finds applications in the pharmaceutical industry for the synthesis of various drug intermediates. It is also used in the polymer industry for the development of certain types of resins and coatings. Additionally, it has applications in sensors and as a precursor in the electronics industry for semiconductor materials.

About

CAS No 90271-37-7
English Name 1-(3-Nitrophenyl)ethanamine
Molecular Formula C8H10N2O2
Molecular Weight 166.1772 g/mol
SMILES CC(C1=CC(=CC=C1)[N+](=O)[O-])N
InChIKey AVIBPONLEKDCPQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

1-(3-Nitrophenyl)ethanamine is a colorless to white crystalline solid with a molecular weight of app...

Compound Q&A

How is 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7) typically synthesized?

1-(3-Nitrophenyl)ethanamine is commonly synthesized through a condensation reaction between 3-nitrop...

Compound Q&A

What precautions should be taken when handling 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

When handling 1-(3-Nitrophenyl)ethanamine, it is essential to wear appropriate personal protective e...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...