Compound Q&A

How is 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7) typically synthesized?

Answer

1-(3-Nitrophenyl)ethanamine
1-(3-Nitrophenyl)ethanamine is commonly synthesized through a condensation reaction between 3-nitrophenol and ethylamine. The reaction is typically carried out in the presence of a catalyst like sodium acetate to enhance the yield and selectivity. The final product is usually purified by recrystallization from an appropriate solvent.

About

CAS No 90271-37-7
English Name 1-(3-Nitrophenyl)ethanamine
Molecular Formula C8H10N2O2
Molecular Weight 166.18 g/mol
SMILES CC(C1=CC(=CC=C1)[N+](=O)[O-])N
InChIKey AVIBPONLEKDCPQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

1-(3-Nitrophenyl)ethanamine is a colorless to white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

1-(3-Nitrophenyl)ethanamine finds applications in the pharmaceutical industry for the synthesis of v...

Compound Q&A

What precautions should be taken when handling 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

When handling 1-(3-Nitrophenyl)ethanamine, it is essential to wear appropriate personal protective e...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...