Compound Q&A

How is 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7) typically synthesized?

Answer

1-(3-Nitrophenyl)ethanamine
1-(3-Nitrophenyl)ethanamine is commonly synthesized through a condensation reaction between 3-nitrophenol and ethylamine. The reaction is typically carried out in the presence of a catalyst like sodium acetate to enhance the yield and selectivity. The final product is usually purified by recrystallization from an appropriate solvent.

About

CAS No 90271-37-7
English Name 1-(3-Nitrophenyl)ethanamine
Molecular Formula C8H10N2O2
Molecular Weight 166.1772 g/mol
SMILES CC(C1=CC(=CC=C1)[N+](=O)[O-])N
InChIKey AVIBPONLEKDCPQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

1-(3-Nitrophenyl)ethanamine is a colorless to white crystalline solid with a molecular weight of app...

Compound Q&A

What industries use 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

1-(3-Nitrophenyl)ethanamine finds applications in the pharmaceutical industry for the synthesis of v...

Compound Q&A

What precautions should be taken when handling 1-(3-Nitrophenyl)ethanamine (CAS: 90271-37-7)?

When handling 1-(3-Nitrophenyl)ethanamine, it is essential to wear appropriate personal protective e...

Compound Q&A

How should waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane be handled?

Waste containing (6-Bromo-2-naphthyl)oxy](dimethyl)(2-methyl-2-propanyl)silane (...

100751-65-3[(6-Bromo-2-naphthyl...
Compound Q&A

How is 7-Fluoro-4-isoquinolinecarboxylic acid (CAS: 1841081-40-0) typically synthesized?

7-Fluoro-4-isoquinolinecarboxylic acid can be synthesized via a multi-step proce...

1841081-40-07-Fluoro-4-isoquinol...
Compound Q&A

What are the physical and chemical properties of 2,3,5,6-Tetrabromothieno[3,2-b]thiophene (CAS: 124638-53-5)?

2,3,5,6-Tetrabromothieno[3,2-b]thiophene is a crystalline compound with a high m...

124638-53-52,3,5,6-Tetrabromoth...
Compound Q&A

Is 1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indole-4-carboxamide (CAS: 1542705-92-9) safe?

1-[4-(Benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methyl-1H-indol...

1542705-92-91-[4-(Benzylamino)-7...