Compound Q&A

What precautions should be taken when handling 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

Answer

1,2,4-Butanetricarboxylic acid
When handling 1,2,4-Butanetricarboxylic acid, protective equipment such as gloves, goggles, and lab coats should be worn to protect against skin and eye irritation. It should be stored in a dry, well-ventilated area, away from heat and sources of ignition. In case of spill, it should be cleaned up carefully according to the Material Safety Data Sheet (MSDS/SDS) guidelines to prevent environmental contamination and exposure risks.

About

CAS No 923-42-2
English Name 1,2,4-Butanetricarboxylic acid
Molecular Formula C7H10O6
Molecular Weight 190.15 g/mol
SMILES C(CC(=O)O)C(CC(=O)O)C(=O)O
InChIKey LOGBRYZYTBQBTB-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

1,2,4-Butanetricarboxylic acid is a crystalline solid with a molecular weight of approximately 154.0...

Compound Q&A

How is 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2) typically synthesized?

1,2,4-Butanetricarboxylic acid is typically synthesized through the hydration of 1,2,4-butatriene fo...

Compound Q&A

What industries use 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

1,2,4-Butanetricarboxylic acid is used in various industries, including pharmaceuticals for the synt...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...