Compound Q&A

How is 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2) typically synthesized?

Answer

1,2,4-Butanetricarboxylic acid
1,2,4-Butanetricarboxylic acid is typically synthesized through the hydration of 1,2,4-butatriene followed by oxidation. The process often uses chromium(VI) salts as catalysts to ensure high selectivity and yield. The reaction is carried out under controlled conditions to optimize product purity and yield.

About

CAS No 923-42-2
English Name 1,2,4-Butanetricarboxylic acid
Molecular Formula C7H10O6
Molecular Weight 190.15 g/mol
SMILES C(CC(=O)O)C(CC(=O)O)C(=O)O
InChIKey LOGBRYZYTBQBTB-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

1,2,4-Butanetricarboxylic acid is a crystalline solid with a molecular weight of approximately 154.0...

Compound Q&A

What industries use 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

1,2,4-Butanetricarboxylic acid is used in various industries, including pharmaceuticals for the synt...

Compound Q&A

What precautions should be taken when handling 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

When handling 1,2,4-Butanetricarboxylic acid, protective equipment such as gloves, goggles, and lab ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...