Compound Q&A

What industries use 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

Answer

1,2,4-Butanetricarboxylic acid is used in various industries, including pharmaceuticals for the synthesis of certain drugs, polymers for plastic production, and in the development of sensors and semiconductors due to its carboxylic acid functionality that is useful in various chemical modifications and reactions.

About

CAS No 923-42-2

English Name 1,2,4-Butanetricarboxylic acid

Molecular Formula C7H10O6

Molecular Weight 190.15099999999998 g/mol

SMILES C(CC(=O)O)C(CC(=O)O)C(=O)O

InChIKey LOGBRYZYTBQBTB-UHFFFAOYSA-N

Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

1,2,4-Butanetricarboxylic acid is a crystalline solid with a molecular weight of approximately 154.0...

Compound Q&A

How is 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2) typically synthesized?

1,2,4-Butanetricarboxylic acid is typically synthesized through the hydration of 1,2,4-butatriene fo...

Compound Q&A

What precautions should be taken when handling 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

When handling 1,2,4-Butanetricarboxylic acid, protective equipment such as gloves, goggles, and lab ...

Compound Q&A

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) is generally considered safe whe...

94045-97-32-Nitro-3,5,6-trimet...

Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex or...

17691-02-04-Aminophenyl 4-O-be...

Compound Q&A

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

When handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9), it is imp...

1060801-39-93-bromo-N,N-dimethyl...

Compound Q&A

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) shoul...

607371-03-95-Bromo-N~4~-ethyl-3...

What industries use 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

Answer

About

Related Q&A

What are the physical and chemical properties of 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

How is 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2) typically synthesized?

What precautions should be taken when handling 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Suppliers

Alway Chem, China

ShangHaiYiJi Industrial Co Ltd

Shanghai Haoshen Trading Co., Ltd.

JiangSuAiKangShengWuYiYaoYanFa Co Ltd

Leyan Reagents

HePeng （ ShangHai ） Biotechnology Co Ltd