Compound Q&A

What are the physical and chemical properties of 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

Answer

1,2,4-Butanetricarboxylic acid
1,2,4-Butanetricarboxylic acid is a crystalline solid with a molecular weight of approximately 154.08 g/mol. It is slightly soluble in water but highly soluble in organic solvents like ethanol. Chemically, it is a tricarboxylic acid and exhibits moderate reactivity, particularly in esterification and amide formation reactions.

About

CAS No 923-42-2
English Name 1,2,4-Butanetricarboxylic acid
Molecular Formula C7H10O6
Molecular Weight 190.15099999999998 g/mol
SMILES C(CC(=O)O)C(CC(=O)O)C(=O)O
InChIKey LOGBRYZYTBQBTB-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2) typically synthesized?

1,2,4-Butanetricarboxylic acid is typically synthesized through the hydration of 1,2,4-butatriene fo...

Compound Q&A

What industries use 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

1,2,4-Butanetricarboxylic acid is used in various industries, including pharmaceuticals for the synt...

Compound Q&A

What precautions should be taken when handling 1,2,4-Butanetricarboxylic acid (CAS: 923-42-2)?

When handling 1,2,4-Butanetricarboxylic acid, protective equipment such as gloves, goggles, and lab ...

Compound Q&A

Is 2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) safe?

2-Nitro-3,5,6-trimethylphenol (CAS: 94045-97-3) is generally considered safe whe...

94045-97-32-Nitro-3,5,6-trimet...
Compound Q&A

What is 4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside (CAS: 17691-02-0)?

4-Aminophenyl 4-O-beta-D-galactopyranosyl-beta-D-glucopyranoside is a complex or...

17691-02-04-Aminophenyl 4-O-be...
Compound Q&A

What precautions should be taken when handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9)?

When handling 3-bromo-N,N-dimethylpyridin-2-amine (CAS: 1060801-39-9), it is imp...

1060801-39-93-bromo-N,N-dimethyl...
Compound Q&A

How should waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) be handled?

Waste containing 5-Bromo-N~4~-ethyl-3,4-pyridinediamine (CAS: 607371-03-9) shoul...

607371-03-95-Bromo-N~4~-ethyl-3...