Compound Q&A

What precautions should be taken when handling Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate (CAS: 183170-69-6)?

Answer

Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate
When handling Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate, it is essential to use appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. Handle the compound in a well-ventilated area or fume hood to minimize exposure to vapors. Spills should be handled according to the material safety data sheet (MSDS/SDS) guidelines. Always consult the SDS for detailed safety information and follow all safety protocols.

About

English Name Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate
Molecular Formula C12H23NO3
Molecular Weight 229.32 g/mol
SMILES CC(C1CCN(CC1)C(=O)OC(C)(C)C)O
InChIKey SQOMPUDOUGDJPH-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate (CAS: 183170-69-6)?

Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate has a crystalline form with a molecular weight...

Compound Q&A

How is Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate (CAS: 183170-69-6) typically synthesized?

Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate is typically synthesized through the reaction ...

Compound Q&A

What industries use Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate (CAS: 183170-69-6)?

Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate is used in the pharmaceutical industry for the...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...