Compound Q&A

What industries use Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate (CAS: 183170-69-6)?

Answer

Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate
Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate is used in the pharmaceutical industry for the synthesis of drug intermediates. It is also utilized in the polymer industry for the modification of polymers, and in the semiconductor industry for the production of functional materials. Additionally, it has applications in sensor technology and as a chemical reagent.

About

English Name Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate
Molecular Formula C12H23NO3
Molecular Weight 229.32 g/mol
SMILES CC(C1CCN(CC1)C(=O)OC(C)(C)C)O
InChIKey SQOMPUDOUGDJPH-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate (CAS: 183170-69-6)?

Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate has a crystalline form with a molecular weight...

Compound Q&A

How is Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate (CAS: 183170-69-6) typically synthesized?

Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate is typically synthesized through the reaction ...

Compound Q&A

What precautions should be taken when handling Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate (CAS: 183170-69-6)?

When handling Tert-butyl 4-(1-hydroxyethyl)piperidine-1-carboxylate, it is essential to use appropri...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...