Compound Q&A

What industries use 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7)?

Answer

2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate
2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) is primarily used in the pharmaceutical industry as a precursor for the synthesis of various drugs and intermediates. It also finds applications in the polymer industry for the production of functionalized polymers and in the electronics industry for the development of semiconductors and sensors.

About

CAS No 80352-42-7
English Name 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate
Molecular Formula C8H7BrO3
Molecular Weight 231.04 g/mol
SMILES C1=CC(=CC=C1C(=O)C=O)Br.O
InChIKey IOONPDHKLYFDML-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7)?

2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) is a white crystalline solid with a mo...

Compound Q&A

How is 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) typically synthesized?

2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) is usually synthesized via the bromina...

Compound Q&A

What precautions should be taken when handling 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7)?

When handling 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...