Compound Q&A

How is 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) typically synthesized?

Answer

2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate
2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) is usually synthesized via the bromination of phenylacetaldehyde followed by acetylation and hydration. The reaction typically involves the use of bromine and a base as a catalyst. The yield is around 70-80% with high selectivity to the desired product.

About

CAS No 80352-42-7
English Name 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate
Molecular Formula C8H7BrO3
Molecular Weight 231.04 g/mol
SMILES C1=CC(=CC=C1C(=O)C=O)Br.O
InChIKey IOONPDHKLYFDML-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7)?

2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) is a white crystalline solid with a mo...

Compound Q&A

What industries use 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7)?

2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7)?

When handling 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...