Compound Q&A

What are the physical and chemical properties of 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7)?

Answer

2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate
2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) is a white crystalline solid with a molecular weight of approximately 240.02 g/mol. It has a low solubility in water (0.1 g/100 mL at 25°C) and is relatively stable under normal conditions. The compound is reactive towards nucleophiles and can undergo substitution reactions. It is typically stored at room temperature and should be protected from moisture.

About

CAS No 80352-42-7
English Name 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate
Molecular Formula C8H7BrO3
Molecular Weight 231.04 g/mol
SMILES C1=CC(=CC=C1C(=O)C=O)Br.O
InChIKey IOONPDHKLYFDML-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) typically synthesized?

2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) is usually synthesized via the bromina...

Compound Q&A

What industries use 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7)?

2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7) is primarily used in the pharmaceutica...

Compound Q&A

What precautions should be taken when handling 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7)?

When handling 2-(4-Bromophenyl)-2-oxoacetaldehyde hydrate (CAS: 80352-42-7), it is essential to wear...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...