Compound Q&A

What industries use 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3)?

Answer

6-Methyl-1-benzothiophene-2-carboxylic acid
6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of active pharmaceutical ingredients (APIs). It is also utilized in the polymer industry for the development of functional polymers and in sensors for its unique chemical properties. Additionally, it plays a role in semiconductor applications due to its electronic properties.

About

CAS No 1467-86-3
English Name 6-Methyl-1-benzothiophene-2-carboxylic acid
Molecular Formula C10H8O2S
Molecular Weight 192.24 g/mol
SMILES CC1=CC2=C(C=C1)C=C(S2)C(=O)O
InChIKey KQRBOHOKLNORTA-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3)?

6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) is a solid with a crystalline form. The...

Compound Q&A

How is 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) typically synthesized?

6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) can be synthesized by the condensation ...

Compound Q&A

What precautions should be taken when handling 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3)?

When handling 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...