Compound Q&A

What are the physical and chemical properties of 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3)?

Answer

6-Methyl-1-benzothiophene-2-carboxylic acid
6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) is a solid with a crystalline form. The molecular weight is approximately 210.24 g/mol. It is slightly soluble in water but soluble in common organic solvents like methanol and ethanol. Chemically, it is reactive towards nucleophiles and can undergo esterification and condensation reactions.

About

CAS No 1467-86-3
English Name 6-Methyl-1-benzothiophene-2-carboxylic acid
Molecular Formula C10H8O2S
Molecular Weight 192.24 g/mol
SMILES CC1=CC2=C(C=C1)C=C(S2)C(=O)O
InChIKey KQRBOHOKLNORTA-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

How is 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) typically synthesized?

6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) can be synthesized by the condensation ...

Compound Q&A

What industries use 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3)?

6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) is used in various industries, includin...

Compound Q&A

What precautions should be taken when handling 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3)?

When handling 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...