Compound Q&A

How is 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) typically synthesized?

Answer

6-Methyl-1-benzothiophene-2-carboxylic acid
6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) can be synthesized by the condensation of 6-methyl-1-benzothiophenecarbaldehyde with formic acid under the presence of a suitable catalyst such as p-toluenesulfonic acid. The reaction is typically performed in a solvent like methanol or ethanol to improve solubility and yield. The product can be purified by recrystallization or column chromatography.

About

CAS No 1467-86-3
English Name 6-Methyl-1-benzothiophene-2-carboxylic acid
Molecular Formula C10H8O2S
Molecular Weight 192.24 g/mol
SMILES CC1=CC2=C(C=C1)C=C(S2)C(=O)O
InChIKey KQRBOHOKLNORTA-UHFFFAOYSA-N
Last Updated: 2025-11-01 22:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3)?

6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) is a solid with a crystalline form. The...

Compound Q&A

What industries use 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3)?

6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3) is used in various industries, includin...

Compound Q&A

What precautions should be taken when handling 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3)?

When handling 6-Methyl-1-benzothiophene-2-carboxylic acid (CAS: 1467-86-3), it is essential to wear ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...