Compound Q&A

What precautions should be taken when handling (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0)?

Answer

(3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid
When handling this compound, it is important to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up carefully using appropriate absorbents, and the area should be decontaminated. Refer to the Material Safety Data Sheet (MSDS) for specific safety guidelines and emergency procedures.

About

English Name (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid
Molecular Formula C21H23NO4
Molecular Weight 353.42 g/mol
SMILES CC(C)[C@H](CC(=O)O)NC(=O)OCC1c2ccccc2-c3ccccc13
InChIKey KFDMTAMWOIQTOB-IBGZPJMESA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0)?

The compound is an amide with a molecular weight of approximately 416.43 g/mol. It has a crystalline...

Compound Q&A

How is (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0) typically synthesized?

This compound is typically synthesized through multistep organic synthesis, involving the coupling o...

Compound Q&A

What industries use (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0)?

This compound is primarily used in the pharmaceutical industry for the synthesis of drug candidates....

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...