Compound Q&A

How is (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0) typically synthesized?

Answer

(3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid
This compound is typically synthesized through multistep organic synthesis, involving the coupling of fluorenylmethanol with an amino acid derivative. The process usually requires the use of coupling reagents such as HATU or EDC, and a base like DIPEA. The yield is generally around 70-80%, and the reaction is performed under anhydrous conditions to avoid side reactions.

About

English Name (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid
Molecular Formula C21H23NO4
Molecular Weight 353.42 g/mol
SMILES CC(C)[C@H](CC(=O)O)NC(=O)OCC1c2ccccc2-c3ccccc13
InChIKey KFDMTAMWOIQTOB-IBGZPJMESA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0)?

The compound is an amide with a molecular weight of approximately 416.43 g/mol. It has a crystalline...

Compound Q&A

What industries use (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0)?

This compound is primarily used in the pharmaceutical industry for the synthesis of drug candidates....

Compound Q&A

What precautions should be taken when handling (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...