Compound Q&A

What are the physical and chemical properties of (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0)?

Answer

(3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid
The compound is an amide with a molecular weight of approximately 416.43 g/mol. It has a crystalline form and is insoluble in water but soluble in organic solvents. The compound is relatively stable under normal conditions but can react with strong bases or acids. It is not flammable and has a low reactivity under standard laboratory conditions.

About

English Name (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid
Molecular Formula C21H23NO4
Molecular Weight 353.42 g/mol
SMILES CC(C)[C@H](CC(=O)O)NC(=O)OCC1c2ccccc2-c3ccccc13
InChIKey KFDMTAMWOIQTOB-IBGZPJMESA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0) typically synthesized?

This compound is typically synthesized through multistep organic synthesis, involving the coupling o...

Compound Q&A

What industries use (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0)?

This compound is primarily used in the pharmaceutical industry for the synthesis of drug candidates....

Compound Q&A

What precautions should be taken when handling (3S)-3-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-methylpentanoic acid (CAS: 266318-79-0)?

When handling this compound, it is important to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...