Compound Q&A

What precautions should be taken when handling Linagliptin Impurity G (CAS: 668270-11-9)?

Answer

Linagliptin Impurity G
Handling Linagliptin Impurity G requires the use of personal protective equipment (PPE) such as gloves, safety glasses, and a lab coat. It should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. In the event of a spill, it should be cleaned up using appropriate safety procedures and materials. For more detailed safety information, refer to the Safety Data Sheet (SDS) for Linagliptin Impurity G.

About

English Name Linagliptin Impurity G
Molecular Formula C25H28N8O2
Molecular Weight 30.07 g/mol
SMILES CC#CCN1C2=C(N=C1N3CCCC(C3)N)N(C(=O)N(C2=O)CC4=NC5=CC=CC=C5C(=N4)C)C
InChIKey OTMSDBZUPAUEDD-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Linagliptin Impurity G (CAS: 668270-11-9)?

Linagliptin Impurity G is a white to off-white crystalline solid with a molecular weight of approxim...

Compound Q&A

How is Linagliptin Impurity G (CAS: 668270-11-9) typically synthesized?

Linagliptin Impurity G is typically synthesized through the modification of the parent compound, Lin...

Compound Q&A

What industries use Linagliptin Impurity G (CAS: 668270-11-9)?

Linagliptin Impurity G is primarily used in the pharmaceutical industry as a quality control and imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...