Compound Q&A

What are the physical and chemical properties of Linagliptin Impurity G (CAS: 668270-11-9)?

Answer

Linagliptin Impurity G
Linagliptin Impurity G is a white to off-white crystalline solid with a molecular weight of approximately 364.34 g/mol. It is poorly soluble in water but soluble in organic solvents like methanol and ethanol. The impurity is less reactive than the parent compound, Linagliptin, but can still undergo similar chemical reactions under certain conditions, such as acidic or basic catalysis.

About

English Name Linagliptin Impurity G
Molecular Formula C25H28N8O2
Molecular Weight 30.07 g/mol
SMILES CC#CCN1C2=C(N=C1N3CCCC(C3)N)N(C(=O)N(C2=O)CC4=NC5=CC=CC=C5C(=N4)C)C
InChIKey OTMSDBZUPAUEDD-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is Linagliptin Impurity G (CAS: 668270-11-9) typically synthesized?

Linagliptin Impurity G is typically synthesized through the modification of the parent compound, Lin...

Compound Q&A

What industries use Linagliptin Impurity G (CAS: 668270-11-9)?

Linagliptin Impurity G is primarily used in the pharmaceutical industry as a quality control and imp...

Compound Q&A

What precautions should be taken when handling Linagliptin Impurity G (CAS: 668270-11-9)?

Handling Linagliptin Impurity G requires the use of personal protective equipment (PPE) such as glov...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...