Compound Q&A

What industries use Linagliptin Impurity G (CAS: 668270-11-9)?

Answer

Linagliptin Impurity G
Linagliptin Impurity G is primarily used in the pharmaceutical industry as a quality control and impurity reference for Linagliptin, a DPP-4 inhibitor used in the treatment of type 2 diabetes. It is not widely used in other industries such as polymers, sensors, or semiconductors.

About

English Name Linagliptin Impurity G
Molecular Formula C25H28N8O2
Molecular Weight 30.07 g/mol
SMILES CC#CCN1C2=C(N=C1N3CCCC(C3)N)N(C(=O)N(C2=O)CC4=NC5=CC=CC=C5C(=N4)C)C
InChIKey OTMSDBZUPAUEDD-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Linagliptin Impurity G (CAS: 668270-11-9)?

Linagliptin Impurity G is a white to off-white crystalline solid with a molecular weight of approxim...

Compound Q&A

How is Linagliptin Impurity G (CAS: 668270-11-9) typically synthesized?

Linagliptin Impurity G is typically synthesized through the modification of the parent compound, Lin...

Compound Q&A

What precautions should be taken when handling Linagliptin Impurity G (CAS: 668270-11-9)?

Handling Linagliptin Impurity G requires the use of personal protective equipment (PPE) such as glov...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...