Compound Q&A

What industries use [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3)?

Answer

[4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol
This compound is primarily used in the pharmaceutical industry for the synthesis of complex drug molecules due to its unique electronic properties. It also finds applications in the polymer industry for developing advanced materials with specific functional groups. Additionally, it is used in the sensor and semiconductor industries for its electronic and optical properties.

About

English Name [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol
Molecular Formula C18H18F4O2
Molecular Weight 342.33 g/mol
SMILES OCc1cc(ccc1c1cc(C(C)C)c(cc1OC)F)C(F)(F)F
InChIKey XSZIJSCGSTXKKI-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3)?

The compound [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 8755...

Compound Q&A

How is [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3) typically synthesized?

This compound is typically synthesized via a multi-step process involving Friedel-Crafts alkylation,...

Compound Q&A

What precautions should be taken when handling [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3)?

When handling [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...