Compound Q&A

How is [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3) typically synthesized?

Answer

[4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol
This compound is typically synthesized via a multi-step process involving Friedel-Crafts alkylation, followed by a series of protective group manipulations and deprotection steps. The synthesis involves the use of strong Lewis acids and organic solvents. The final step involves methanolysis to obtain the desired methanol derivative with excellent yield and selectivity.

About

English Name [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol
Molecular Formula C18H18F4O2
Molecular Weight 342.33 g/mol
SMILES OCc1cc(ccc1c1cc(C(C)C)c(cc1OC)F)C(F)(F)F
InChIKey XSZIJSCGSTXKKI-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3)?

The compound [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 8755...

Compound Q&A

What industries use [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex drug mol...

Compound Q&A

What precautions should be taken when handling [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3)?

When handling [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...