Compound Q&A

What are the physical and chemical properties of [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3)?

Answer

[4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol
The compound [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3) is a crystalline solid with a molecular weight of approximately 544.95 g/mol. It has low water solubility but good solubility in organic solvents like methanol. This compound shows reactive electrophilic substitution properties and is less reactive towards nucleophilic attacks.

About

English Name [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol
Molecular Formula C18H18F4O2
Molecular Weight 342.33 g/mol
SMILES OCc1cc(ccc1c1cc(C(C)C)c(cc1OC)F)C(F)(F)F
InChIKey XSZIJSCGSTXKKI-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3) typically synthesized?

This compound is typically synthesized via a multi-step process involving Friedel-Crafts alkylation,...

Compound Q&A

What industries use [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3)?

This compound is primarily used in the pharmaceutical industry for the synthesis of complex drug mol...

Compound Q&A

What precautions should be taken when handling [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875548-97-3)?

When handling [4'-Fluoro-5'-isopropyl-2'-methoxy-4-(trifluoromethyl)-2-biphenylyl]methanol (CAS: 875...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...