Compound Q&A

What precautions should be taken when handling Bromo(mesityl)magnesium (CAS: 2633-66-1)?

Answer

Bromo(mesityl)magnesium
When handling Bromo(mesityl)magnesium (CAS: 2633-66-1), it is crucial to use appropriate Personal Protective Equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize exposure. Safety Data Sheets (SDS) should be consulted for specific handling and disposal instructions, and spills should be cleaned up immediately using appropriate absorbents and neutralizing agents if necessary.

About

CAS No 2633-66-1
English Name Bromo(mesityl)magnesium
Molecular Formula C9H11BrMg
Molecular Weight 223.396 g/mol
SMILES CC1=CC(=[C-]C(=C1)C)C.[Mg+2].[Br-]
InChIKey YXVSITSUDRGILL-UHFFFAOYSA-M
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bromo(mesityl)magnesium (CAS: 2633-66-1)?

Bromo(mesityl)magnesium (CAS: 2633-66-1) is a colorless to light yellow liquid with a molecular weig...

Compound Q&A

How is Bromo(mesityl)magnesium (CAS: 2633-66-1) typically synthesized?

Bromo(mesityl)magnesium is typically synthesized through the reaction of bromomethane and mesityl ox...

Compound Q&A

What industries use Bromo(mesityl)magnesium (CAS: 2633-66-1)?

Bromo(mesityl)magnesium (CAS: 2633-66-1) is used in various industries, including pharmaceuticals, w...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...