Compound Q&A

What industries use Bromo(mesityl)magnesium (CAS: 2633-66-1)?

Answer

Bromo(mesityl)magnesium
Bromo(mesityl)magnesium (CAS: 2633-66-1) is used in various industries, including pharmaceuticals, where it serves as a precursor in the synthesis of complex organic molecules. It is also utilized in the production of polymers, where its reactivity allows for the introduction of specific functional groups, and in the development of sensors and semiconductors due to its ability to form stable organometallic complexes.

About

CAS No 2633-66-1
English Name Bromo(mesityl)magnesium
Molecular Formula C9H11BrMg
Molecular Weight 223.4 g/mol
SMILES CC1=CC(=[C-]C(=C1)C)C.[Mg+2].[Br-]
InChIKey YXVSITSUDRGILL-UHFFFAOYSA-M
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bromo(mesityl)magnesium (CAS: 2633-66-1)?

Bromo(mesityl)magnesium (CAS: 2633-66-1) is a colorless to light yellow liquid with a molecular weig...

Compound Q&A

How is Bromo(mesityl)magnesium (CAS: 2633-66-1) typically synthesized?

Bromo(mesityl)magnesium is typically synthesized through the reaction of bromomethane and mesityl ox...

Compound Q&A

What precautions should be taken when handling Bromo(mesityl)magnesium (CAS: 2633-66-1)?

When handling Bromo(mesityl)magnesium (CAS: 2633-66-1), it is crucial to use appropriate Personal Pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...