Compound Q&A

How is Bromo(mesityl)magnesium (CAS: 2633-66-1) typically synthesized?

Answer

Bromo(mesityl)magnesium
Bromo(mesityl)magnesium is typically synthesized through the reaction of bromomethane and mesityl oxide with magnesium in an organic solvent like tetrahydrofuran (THF). The process involves the coordination of bromomethane and mesityl oxide with magnesium, followed by the formation of the Grignard reagent. This method provides good yield and selectivity.

About

CAS No 2633-66-1
English Name Bromo(mesityl)magnesium
Molecular Formula C9H11BrMg
Molecular Weight 223.396 g/mol
SMILES CC1=CC(=[C-]C(=C1)C)C.[Mg+2].[Br-]
InChIKey YXVSITSUDRGILL-UHFFFAOYSA-M
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of Bromo(mesityl)magnesium (CAS: 2633-66-1)?

Bromo(mesityl)magnesium (CAS: 2633-66-1) is a colorless to light yellow liquid with a molecular weig...

Compound Q&A

What industries use Bromo(mesityl)magnesium (CAS: 2633-66-1)?

Bromo(mesityl)magnesium (CAS: 2633-66-1) is used in various industries, including pharmaceuticals, w...

Compound Q&A

What precautions should be taken when handling Bromo(mesityl)magnesium (CAS: 2633-66-1)?

When handling Bromo(mesityl)magnesium (CAS: 2633-66-1), it is crucial to use appropriate Personal Pr...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...