Compound Q&A

What are the physical and chemical properties of Bromo(mesityl)magnesium (CAS: 2633-66-1)?

Answer

Bromo(mesityl)magnesium
Bromo(mesityl)magnesium (CAS: 2633-66-1) is a colorless to light yellow liquid with a molecular weight of approximately 211.4 g/mol. It has a low solubility in water but is highly soluble in organic solvents like ethers and alcohols. Chemically, it is highly reactive, particularly towards proton donors, and can undergo Grignard-type reactions, making it a valuable reagent in organic synthesis.

About

CAS No 2633-66-1
English Name Bromo(mesityl)magnesium
Molecular Formula C9H11BrMg
Molecular Weight 223.4 g/mol
SMILES CC1=CC(=[C-]C(=C1)C)C.[Mg+2].[Br-]
InChIKey YXVSITSUDRGILL-UHFFFAOYSA-M
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is Bromo(mesityl)magnesium (CAS: 2633-66-1) typically synthesized?

Bromo(mesityl)magnesium is typically synthesized through the reaction of bromomethane and mesityl ox...

Compound Q&A

What industries use Bromo(mesityl)magnesium (CAS: 2633-66-1)?

Bromo(mesityl)magnesium (CAS: 2633-66-1) is used in various industries, including pharmaceuticals, w...

Compound Q&A

What precautions should be taken when handling Bromo(mesityl)magnesium (CAS: 2633-66-1)?

When handling Bromo(mesityl)magnesium (CAS: 2633-66-1), it is crucial to use appropriate Personal Pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...