Compound Q&A

What precautions should be taken when handling 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

Answer

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
When handling 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, it is crucial to take appropriate safety measures. Always wear personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated environment or a fume hood to minimize exposure to any fumes. Spills should be immediately cleaned up with appropriate materials, and the area should be well-ventilated. For detailed safety information, refer to the Material Safety Data Sheet (MSDS/SDS) for this compound.

About

CAS No 98534-81-7
English Name 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Molecular Formula C11H7F3N2O2
Molecular Weight 256.18 g/mol
SMILES C1=CC=C(C=C1)N2C(=C(C=N2)C(=O)O)C(F)(F)F
InChIKey SMPJBTIFNUUWGQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a crystalline solid with a molecular w...

Compound Q&A

How is 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7) typically synthesized?

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is usually synthesized through a multi-st...

Compound Q&A

What industries use 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is primarily used in the pharmaceutical i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...