Compound Q&A

What industries use 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

Answer

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is primarily used in the pharmaceutical industry as a precursor for drug development. It also finds applications in polymer synthesis, where its unique chemical properties make it suitable for functional polymers. Additionally, it can be used in the production of advanced sensors and semiconductors due to its stability and reactivity.

About

CAS No 98534-81-7
English Name 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Molecular Formula C11H7F3N2O2
Molecular Weight 256.18 g/mol
SMILES C1=CC=C(C=C1)N2C(=C(C=N2)C(=O)O)C(F)(F)F
InChIKey SMPJBTIFNUUWGQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a crystalline solid with a molecular w...

Compound Q&A

How is 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7) typically synthesized?

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is usually synthesized through a multi-st...

Compound Q&A

What precautions should be taken when handling 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

When handling 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, it is crucial to take appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...