Compound Q&A

What are the physical and chemical properties of 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

Answer

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a crystalline solid with a molecular weight of approximately 281.14 g/mol. It has a low solubility in water but is more soluble in organic solvents like DMSO and acetonitrile. Chemically, it is known for its stability and reactivity in acid and base conditions, but it is less reactive in general compared to other carboxylic acids.

About

CAS No 98534-81-7
English Name 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Molecular Formula C11H7F3N2O2
Molecular Weight 256.18 g/mol
SMILES C1=CC=C(C=C1)N2C(=C(C=N2)C(=O)O)C(F)(F)F
InChIKey SMPJBTIFNUUWGQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7) typically synthesized?

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is usually synthesized through a multi-st...

Compound Q&A

What industries use 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

When handling 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, it is crucial to take appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...