Compound Q&A

How is 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7) typically synthesized?

Answer

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is usually synthesized through a multi-step process. The key steps involve the formation of the pyrazole ring via condensation reactions, followed by the introduction of the trifluoromethyl group and the carboxylation step. Common catalysts include triphenylphosphine and various carboxylation agents like PCl5 or PMPCl. The overall yield can be improved by optimizing reaction conditions and using appropriate solvents.

About

CAS No 98534-81-7
English Name 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid
Molecular Formula C11H7F3N2O2
Molecular Weight 256.18 g/mol
SMILES C1=CC=C(C=C1)N2C(=C(C=N2)C(=O)O)C(F)(F)F
InChIKey SMPJBTIFNUUWGQ-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is a crystalline solid with a molecular w...

Compound Q&A

What industries use 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid (CAS: 98534-81-7)?

When handling 1-Phenyl-5-(trifluoromethyl)-1H-pyrazole-4-carboxylic acid, it is crucial to take appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...