Compound Q&A

What precautions should be taken when handling 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

Answer

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane
When handling 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane, it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and lab coat. Ensure the use of a fume hood to avoid inhalation risk. Spills should be cleaned up using appropriate absorbent materials and disposing of residues in accordance with local regulations. Refer to the safety data sheet (SDS) for detailed handling and emergency procedures.

About

English Name 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane
Molecular Formula C11H17BO2S
Molecular Weight 224.13 g/mol
SMILES Cc1ccc(s1)B2OC(C)(C)C(C)(C)O2
InChIKey LTOLNTYOBPPFLS-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is a colorless, crystalline solid. It...

Compound Q&A

How is 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5) typically synthesized?

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is typically synthesized via a multis...

Compound Q&A

What industries use 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is used in the pharmaceutical industr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...