Compound Q&A

What are the physical and chemical properties of 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

Answer

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane
4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is a colorless, crystalline solid. It has a molecular weight of approximately 262.15 g/mol and a melting point of 62-64°C. The compound is soluble in organic solvents such as dichloromethane and toluene. It is less soluble in water. Chemically, it is reactive towards nucleophiles and can undergo various transformations such as substitution and addition reactions.

About

English Name 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane
Molecular Formula C11H17BO2S
Molecular Weight 224.13 g/mol
SMILES Cc1ccc(s1)B2OC(C)(C)C(C)(C)O2
InChIKey LTOLNTYOBPPFLS-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

How is 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5) typically synthesized?

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is typically synthesized via a multis...

Compound Q&A

What industries use 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

When handling 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...