Compound Q&A

How is 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5) typically synthesized?

Answer

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane
4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is typically synthesized via a multistep process involving the reaction of thiophene with methyl orthoformate in the presence of a catalyst such as tetrakis(triphenylphosphine)palladium(0). The overall reaction involves the formation of an intermediate, followed by dioxaborolane formation. The yield is generally high, and the method is highly selective.

About

English Name 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane
Molecular Formula C11H17BO2S
Molecular Weight 224.13 g/mol
SMILES Cc1ccc(s1)B2OC(C)(C)C(C)(C)O2
InChIKey LTOLNTYOBPPFLS-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is a colorless, crystalline solid. It...

Compound Q&A

What industries use 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is used in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

When handling 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...