Compound Q&A

What industries use 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

Answer

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane
4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is used in the pharmaceutical industry for the synthesis of medicinal compounds, particularly in the development of nucleoside analogs. It is also used in the polymer industry as a monomer and in the semiconductor industry for the production of organic semiconductors. Additionally, it finds applications in the development of sensors and other advanced materials.

About

English Name 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane
Molecular Formula C11H17BO2S
Molecular Weight 224.13 g/mol
SMILES Cc1ccc(s1)B2OC(C)(C)C(C)(C)O2
InChIKey LTOLNTYOBPPFLS-UHFFFAOYSA-N
Last Updated: 2025-11-01 18:55

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is a colorless, crystalline solid. It...

Compound Q&A

How is 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5) typically synthesized?

4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane is typically synthesized via a multis...

Compound Q&A

What precautions should be taken when handling 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane (CAS: 476004-80-5)?

When handling 4,4,5,5-Tetramethyl-2-(5-methyl-2-thienyl)-1,3,2-dioxaborolane, it is essential to wea...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...