Compound Q&A

What industries use Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2)?

Answer

Ethyl 4-amino-2-methylbenzoate
Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) is used in various industries due to its chemical properties. It finds applications in the pharmaceutical and chemical industries as a starting material for the synthesis of other compounds. Additionally, it is used in the preparation of certain dyes, pigments, and in the development of organic electronic materials for semiconductors and sensors.

About

CAS No 74450-59-2
English Name Ethyl 4-amino-2-methylbenzoate
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES CCOC(=O)C1=C(C=C(C=C1)N)C
InChIKey RXVUWRNRNRPYMT-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2)?

Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) is a white, crystalline solid with a molecular weig...

Compound Q&A

How is Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) typically synthesized?

Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) is synthesized through a multi-step process that be...

Compound Q&A

What precautions should be taken when handling Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2)?

When handling Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2), it is important to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...