Compound Q&A

What are the physical and chemical properties of Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2)?

Answer

Ethyl 4-amino-2-methylbenzoate
Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) is a white, crystalline solid with a molecular weight of approximately 219.22 g/mol. It has a solubility of about 12.8 g/L in water and is relatively stable under normal conditions. The compound is slightly acidic and can react with strong bases to form its conjugate base. It is insoluble in water but soluble in organic solvents like ethanol and acetonitrile.

About

CAS No 74450-59-2
English Name Ethyl 4-amino-2-methylbenzoate
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES CCOC(=O)C1=C(C=C(C=C1)N)C
InChIKey RXVUWRNRNRPYMT-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

How is Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) typically synthesized?

Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) is synthesized through a multi-step process that be...

Compound Q&A

What industries use Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2)?

Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) is used in various industries due to its chemical p...

Compound Q&A

What precautions should be taken when handling Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2)?

When handling Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2), it is important to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...