Compound Q&A

How is Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) typically synthesized?

Answer

Ethyl 4-amino-2-methylbenzoate
Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) is synthesized through a multi-step process that begins with the reaction of 4-amino-2-methylbenzoic acid with ethyl chloroformate in the presence of a base like triethylamine. The reaction yields the ethyl ester as a primary product with good selectivity and yield. Commonly used solvents include dichloromethane or acetonitrile, and the reaction is typically conducted at room temperature.

About

CAS No 74450-59-2
English Name Ethyl 4-amino-2-methylbenzoate
Molecular Formula C10H13NO2
Molecular Weight 179.22 g/mol
SMILES CCOC(=O)C1=C(C=C(C=C1)N)C
InChIKey RXVUWRNRNRPYMT-UHFFFAOYSA-N
Last Updated: 2025-11-01 12:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2)?

Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) is a white, crystalline solid with a molecular weig...

Compound Q&A

What industries use Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2)?

Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2) is used in various industries due to its chemical p...

Compound Q&A

What precautions should be taken when handling Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2)?

When handling Ethyl 4-amino-2-methylbenzoate (CAS: 74450-59-2), it is important to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...